Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Resorcinol, 98%
CAS: 108-46-3 Molecular Formula: C6H6O2 Molecular Weight (g/mol): 110.11 MDL Number: MFCD00002269 InChI Key: GHMLBKRAJCXXBS-UHFFFAOYSA-N Synonym: resorcinol,1,3-benzenediol,resorcin,1,3-dihydroxybenzene,3-hydroxyphenol,m-hydroquinone,resorcine,m-dihydroxybenzene,m-hydroxyphenol,m-benzenediol PubChem CID: 5054 ChEBI: CHEBI:27810 IUPAC Name: benzene-1,3-diol SMILES: C1=CC(=CC(=C1)O)O
| PubChem CID | 5054 |
|---|---|
| CAS | 108-46-3 |
| Molecular Weight (g/mol) | 110.11 |
| ChEBI | CHEBI:27810 |
| MDL Number | MFCD00002269 |
| SMILES | C1=CC(=CC(=C1)O)O |
| Synonym | resorcinol,1,3-benzenediol,resorcin,1,3-dihydroxybenzene,3-hydroxyphenol,m-hydroquinone,resorcine,m-dihydroxybenzene,m-hydroxyphenol,m-benzenediol |
| IUPAC Name | benzene-1,3-diol |
| InChI Key | GHMLBKRAJCXXBS-UHFFFAOYSA-N |
| Molecular Formula | C6H6O2 |
Glucose-6-phosphate dehydrogenase
CAS: 9001-40-5 MDL Number: MFCD00081656 Synonym: EC 1.1.1.49,RP-87086
| CAS | 9001-40-5 |
|---|---|
| MDL Number | MFCD00081656 |
| Synonym | EC 1.1.1.49,RP-87086 |
1-Methyl-1-cyclohexene, 96%
CAS: 591-49-1 Molecular Formula: C7H12 Molecular Weight (g/mol): 96.173 MDL Number: MFCD00001548 InChI Key: CTMHWPIWNRWQEG-UHFFFAOYSA-N Synonym: 1-methyl-1-cyclohexene,cyclohexene, 1-methyl,1-methylcyclohex-1-ene,cyclohexene, methyl,methylcyclohexene,.alpha.-methylcyclohexene,1-methyl-cyclohexene,methyl-1-cyclohexene,2,3,4,5-tetrahydrotoluene,unii-te4p8q2044 PubChem CID: 11574 IUPAC Name: 1-methylcyclohexene SMILES: CC1=CCCCC1
| PubChem CID | 11574 |
|---|---|
| CAS | 591-49-1 |
| Molecular Weight (g/mol) | 96.173 |
| MDL Number | MFCD00001548 |
| SMILES | CC1=CCCCC1 |
| Synonym | 1-methyl-1-cyclohexene,cyclohexene, 1-methyl,1-methylcyclohex-1-ene,cyclohexene, methyl,methylcyclohexene,.alpha.-methylcyclohexene,1-methyl-cyclohexene,methyl-1-cyclohexene,2,3,4,5-tetrahydrotoluene,unii-te4p8q2044 |
| IUPAC Name | 1-methylcyclohexene |
| InChI Key | CTMHWPIWNRWQEG-UHFFFAOYSA-N |
| Molecular Formula | C7H12 |
Dextran, MW ca 75,000
CAS: 9004-54-0 Molecular Formula: (C6H9O5)n(C6H10O5)m Molecular Weight (g/mol): 504.44 MDL Number: MFCD00130935 InChI Key: FZWBNHMXJMCXLU-UHFFFAOYNA-N Synonym: dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal PubChem CID: 4125253 IUPAC Name: Dextran SMILES: O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O
| PubChem CID | 4125253 |
|---|---|
| CAS | 9004-54-0 |
| Molecular Weight (g/mol) | 504.44 |
| MDL Number | MFCD00130935 |
| SMILES | O[C@@H]1[C@@H](O)[C@@H](-*)O[C@H](CO[C@H]2O[C@H](CO-*)[C@@H](O)[C@H](O-*)[C@H]2O)[C@H]1O |
| Synonym | dextran,dextran, mw-86.000 aver.,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydro-2h-pyran-2-yl oxy methyl tetrahydro-2h-pyran-2-yl oxy hexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl oxan-2-yl oxymethyl oxan-2-yl oxyhexanal,2,3,4,5-tetrahydroxy-6-3,4,5-trihydroxy-6-3,4,5-trihydroxy-6-hydroxymethyl tetrahydropyran-2-yl oxymethyl tetrahydropyran-2-yl oxy-hexanal |
| IUPAC Name | Dextran |
| InChI Key | FZWBNHMXJMCXLU-UHFFFAOYNA-N |
| Molecular Formula | (C6H9O5)n(C6H10O5)m |
1,2-Dichlorobenzene 99.0+%, TCI America™
CAS: 95-50-1 Molecular Formula: C6H4Cl2 Molecular Weight (g/mol): 146.998 MDL Number: MFCD00000535 InChI Key: RFFLAFLAYFXFSW-UHFFFAOYSA-N Synonym: o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben PubChem CID: 7239 ChEBI: CHEBI:35290 IUPAC Name: 1,2-dichlorobenzene SMILES: C1=CC=C(C(=C1)Cl)Cl
| PubChem CID | 7239 |
|---|---|
| CAS | 95-50-1 |
| Molecular Weight (g/mol) | 146.998 |
| ChEBI | CHEBI:35290 |
| MDL Number | MFCD00000535 |
| SMILES | C1=CC=C(C(=C1)Cl)Cl |
| Synonym | o-dichlorobenzene,chloroben,o-dichlorbenzol,dilantin db,ortho-dichlorobenzene,2-dichlorobenzene,o-dichlorobenzol,odcb,benzene, 1,2-dichloro,cloroben |
| IUPAC Name | 1,2-dichlorobenzene |
| InChI Key | RFFLAFLAYFXFSW-UHFFFAOYSA-N |
| Molecular Formula | C6H4Cl2 |
| Boiling Point | 256° |
|---|---|
| Physical Form | Solid |
| UN Number | UN3263 |
| Merck Index | 14,4912 |
| Density | 1.03 |
| Percent Purity | 99+% |
| CAS | 288-32-4 |
| MDL Number | MFCD00005183 |
| Flash Point | 145°(293°F) |
| Synonym | Glyoxaline; |
| RTECS Number | NI3325000 |
| Shelf Life | 5 Years |
| Molecular Formula | C{3}H{4}N{2} |
| EINECS Number | 206-019-2 |
| Formula Weight | 68.08 |
| Melting Point | 88-92° |
Allyl chloride, 98%, stabilized
CAS: 107-05-1 Molecular Formula: C3H5Cl Molecular Weight (g/mol): 76.53 MDL Number: MFCD00000984 InChI Key: OSDWBNJEKMUWAV-UHFFFAOYSA-N Synonym: allyl chloride,3-chloro-1-propene,1-propene, 3-chloro,3-chloropropylene,3-chloropropene,chlorallylene,allylchlorid,2-propenyl chloride,1-chloro-2-propene,allylchloride PubChem CID: 7850 ChEBI: CHEBI:82379 IUPAC Name: 3-chloroprop-1-ene SMILES: C=CCCl
| PubChem CID | 7850 |
|---|---|
| CAS | 107-05-1 |
| Molecular Weight (g/mol) | 76.53 |
| ChEBI | CHEBI:82379 |
| MDL Number | MFCD00000984 |
| SMILES | C=CCCl |
| Synonym | allyl chloride,3-chloro-1-propene,1-propene, 3-chloro,3-chloropropylene,3-chloropropene,chlorallylene,allylchlorid,2-propenyl chloride,1-chloro-2-propene,allylchloride |
| IUPAC Name | 3-chloroprop-1-ene |
| InChI Key | OSDWBNJEKMUWAV-UHFFFAOYSA-N |
| Molecular Formula | C3H5Cl |
Methacrylamide, 98%
CAS: 79-39-0 Molecular Formula: C4H7NO Molecular Weight (g/mol): 85.106 MDL Number: MFCD00008018 InChI Key: FQPSGWSUVKBHSU-UHFFFAOYSA-N Synonym: methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide PubChem CID: 6595 ChEBI: CHEBI:51759 IUPAC Name: 2-methylprop-2-enamide SMILES: CC(=C)C(=O)N
| PubChem CID | 6595 |
|---|---|
| CAS | 79-39-0 |
| Molecular Weight (g/mol) | 85.106 |
| ChEBI | CHEBI:51759 |
| MDL Number | MFCD00008018 |
| SMILES | CC(=C)C(=O)N |
| Synonym | methacrylamide,2-methylacrylamide,methacrylic amide,methacrylic acid amide,2-propenamide, 2-methyl,2-methylpropenamide,methacryamide,methylacrylic amide,mhoromer bm801,alpha-methyl acrylic amide |
| IUPAC Name | 2-methylprop-2-enamide |
| InChI Key | FQPSGWSUVKBHSU-UHFFFAOYSA-N |
| Molecular Formula | C4H7NO |
2-Aminoethyl diphenylborinate, 98%
CAS: 524-95-8 Molecular Formula: C14H16BNO Molecular Weight (g/mol): 225.10 MDL Number: MFCD00014823 InChI Key: BLZVCIGGICSWIG-UHFFFAOYSA-N Synonym: 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl PubChem CID: 1598 SMILES: NCCOB(C1=CC=CC=C1)C1=CC=CC=C1
| PubChem CID | 1598 |
|---|---|
| CAS | 524-95-8 |
| Molecular Weight (g/mol) | 225.10 |
| MDL Number | MFCD00014823 |
| SMILES | NCCOB(C1=CC=CC=C1)C1=CC=CC=C1 |
| Synonym | 2-aminoethyl diphenylborinate,2-apb,2-aminoethoxy diphenylborane,2-aminoethoxydiphenylborane,2-aminoethoxydiphenylborate,2-aminoethoxydiphenyl borate,o-2-aminoethyl diphenylborinic acid,b-2-aminoethoxy diphenylborane,2-diphenylboryl oxy ethanamine,borinic acid, o-2-aminoethyl diphenyl |
| InChI Key | BLZVCIGGICSWIG-UHFFFAOYSA-N |
| Molecular Formula | C14H16BNO |
N,N-Dimethylacetamide, anhydrous, 99.8%, packaged under Argon in resealable ChemSeal™ bottles
CAS: 127-19-5 Molecular Formula: C4H9NO Molecular Weight (g/mol): 87.12 MDL Number: MFCD00008686 InChI Key: FXHOOIRPVKKKFG-UHFFFAOYSA-N Synonym: dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine PubChem CID: 31374 ChEBI: CHEBI:84254 IUPAC Name: N,N-dimethylacetamide SMILES: CN(C)C(C)=O
| PubChem CID | 31374 |
|---|---|
| CAS | 127-19-5 |
| Molecular Weight (g/mol) | 87.12 |
| ChEBI | CHEBI:84254 |
| MDL Number | MFCD00008686 |
| SMILES | CN(C)C(C)=O |
| Synonym | dimethylacetamide,dmac,acetamide, n,n-dimethyl,acetdimethylamide,dimethyl acetamide,n,n-dimethyl acetamide,dimethylamide acetate,n,n-dimethylethanamide,dimethylacetone amide,acetyldimethylamine |
| IUPAC Name | N,N-dimethylacetamide |
| InChI Key | FXHOOIRPVKKKFG-UHFFFAOYSA-N |
| Molecular Formula | C4H9NO |
2-Bromoisobutyryl bromide, 97%
CAS: 20769-85-1 Molecular Formula: C4H6Br2O Molecular Weight (g/mol): 229.899 MDL Number: MFCD00000122 InChI Key: YOCIJWAHRAJQFT-UHFFFAOYSA-N Synonym: 2-bromo-2-methylpropionyl bromide,2-bromoisobutyryl bromide,propanoyl bromide, 2-bromo-2-methyl,bibb,2-bromo-2-methylpropionylbromide,unii-627f9n9dya,2-bromoisobutyrylbromide,2-bromo-2-methyl-propionyl bromide,alpha-bromoisobutyryl bromide,2-bromo-2-methyl-propanoyl bromide PubChem CID: 88685 IUPAC Name: 2-bromo-2-methylpropanoyl bromide SMILES: CC(C)(C(=O)Br)Br
| PubChem CID | 88685 |
|---|---|
| CAS | 20769-85-1 |
| Molecular Weight (g/mol) | 229.899 |
| MDL Number | MFCD00000122 |
| SMILES | CC(C)(C(=O)Br)Br |
| Synonym | 2-bromo-2-methylpropionyl bromide,2-bromoisobutyryl bromide,propanoyl bromide, 2-bromo-2-methyl,bibb,2-bromo-2-methylpropionylbromide,unii-627f9n9dya,2-bromoisobutyrylbromide,2-bromo-2-methyl-propionyl bromide,alpha-bromoisobutyryl bromide,2-bromo-2-methyl-propanoyl bromide |
| IUPAC Name | 2-bromo-2-methylpropanoyl bromide |
| InChI Key | YOCIJWAHRAJQFT-UHFFFAOYSA-N |
| Molecular Formula | C4H6Br2O |
Diethylcyanamide, 99+%
CAS: 617-83-4 Molecular Formula: C5H10N2 Molecular Weight (g/mol): 98.15 MDL Number: MFCD00001769 InChI Key: ZZTSQZQUWBFTAT-UHFFFAOYSA-N Synonym: n,n-diethylcyanamide,cyanamide, diethyl,n-cyanodiethylamine,diethylkyanamid,usaf ek-6326,diethylkyanamid czech,cyanodiethylamine,diethylamino carbonitrile,diethyl-cyanamide,aminodiethylcarbonitrile PubChem CID: 12050 IUPAC Name: diethylcyanamide SMILES: CCN(CC)C#N
| PubChem CID | 12050 |
|---|---|
| CAS | 617-83-4 |
| Molecular Weight (g/mol) | 98.15 |
| MDL Number | MFCD00001769 |
| SMILES | CCN(CC)C#N |
| Synonym | n,n-diethylcyanamide,cyanamide, diethyl,n-cyanodiethylamine,diethylkyanamid,usaf ek-6326,diethylkyanamid czech,cyanodiethylamine,diethylamino carbonitrile,diethyl-cyanamide,aminodiethylcarbonitrile |
| IUPAC Name | diethylcyanamide |
| InChI Key | ZZTSQZQUWBFTAT-UHFFFAOYSA-N |
| Molecular Formula | C5H10N2 |
Methyl chloroformate, 99%
CAS: 79-22-1 Molecular Formula: C2H3ClO2 Molecular Weight (g/mol): 94.49 MDL Number: MFCD00000639 InChI Key: XMJHPCRAQCTCFT-UHFFFAOYSA-N Synonym: methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat PubChem CID: 6586 IUPAC Name: methyl carbonochloridate SMILES: COC(Cl)=O
| PubChem CID | 6586 |
|---|---|
| CAS | 79-22-1 |
| Molecular Weight (g/mol) | 94.49 |
| MDL Number | MFCD00000639 |
| SMILES | COC(Cl)=O |
| Synonym | methyl chloroformate,methyl chlorocarbonate,chloroformic acid methyl ester,methoxycarbonyl chloride,carbonochloridic acid, methyl ester,methyl chloridocarbonate,chloro methoxy methanone,metilcloroformiato,k-stoff,methylchloorformiaat |
| IUPAC Name | methyl carbonochloridate |
| InChI Key | XMJHPCRAQCTCFT-UHFFFAOYSA-N |
| Molecular Formula | C2H3ClO2 |
Carnauba wax, refined, No. 1, yellow
CAS: 8015-86-9 MDL Number: MFCD00130724 Synonym: Brazil wax
| CAS | 8015-86-9 |
|---|---|
| MDL Number | MFCD00130724 |
| Synonym | Brazil wax |
Tetramethylammonium chloride, 98+%
CAS: 75-57-0 Molecular Formula: C4H12ClN Molecular Weight (g/mol): 109.6 MDL Number: MFCD00011628 InChI Key: OKIZCWYLBDKLSU-UHFFFAOYSA-M Synonym: tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl PubChem CID: 6379 ChEBI: CHEBI:7070 IUPAC Name: tetramethylazanium;chloride SMILES: C[N+](C)(C)C.[Cl-]
| PubChem CID | 6379 |
|---|---|
| CAS | 75-57-0 |
| Molecular Weight (g/mol) | 109.6 |
| ChEBI | CHEBI:7070 |
| MDL Number | MFCD00011628 |
| SMILES | C[N+](C)(C)C.[Cl-] |
| Synonym | tetramethylammonium chloride,tetramethyl ammonium chloride,tetramine chloride,usaf an-8,n,n,n-trimethylmethanaminium chloride,methanaminium, n,n,n-trimethyl-, chloride,unii-dcq9s88703,tetramethylazanium chloride,ammonium, tetramethyl-, chloride,tetramethylammonium chloride tmacl |
| IUPAC Name | tetramethylazanium;chloride |
| InChI Key | OKIZCWYLBDKLSU-UHFFFAOYSA-M |
| Molecular Formula | C4H12ClN |